Fmoc-L-methionine
N-Fmoc-L-methionine is an N-Fmoc-protected form of L-Methionine. L-Methionine is an essential amino acid that is obtained from our diet. L-Methionine can be found in grain legumes (such as lentils), and poultry. L-Methionine's main function is to act as the primary start sequence on mRNA so that the ribosomes can start translating the mRNA into proteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003769 |
| Pricing | Inquire |
| Cas | 71989-28-1 |
| Molecular Weight | 371.50 |
| Molecular Formula | C20H21NO4S |
| Canonical SMILES | CSCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |