2'-C-b-Methyl-4-deoxyuridine
2'-C-b-Methyl-4-deoxyuridine is an immensely robust antiviral nucleoside analogue extensively employed in the biomedical industry, manifests as an incredible solution for the research of viral infections due to herpes simplex virus types 1 and 2, varicella-zoster virus, and Epstein-Barr virus. Through its selective targeting of viral polymerases, this extraordinary compound remarkably obstructs viral DNA replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1106032-88-5 |
| Pricing | Inquire |
| Cas | 1106032-88-5 |
| Molecular Weight | 242.23 |
| Molecular Formula | C10H14N2O5 |
| Canonical SMILES | CC1(C(C(OC1N2C=CC=NC2=O)CO)O)O |