Griseolutein B
It is produced by the strain of Streptomyces griseoluteus. Griseolutein A and Griseolutein B have similar activitiy against gram-positive and negative bacteria, and Griseolutein B also inhibits rickettsia, trichomonas vaginalis and Ehrlichite ascites cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01289 |
| Pricing | Inquire |
| Cas | 2072-68-6 |
| Molecular Weight | 344.32 |
| Molecular Formula | C17H16N2O6 |
| Canonical SMILES | COC1=CC=C(C2=NC3=CC=CC(=C3N=C12)C(=O)O)COC(CO)O |