Nalidixic acid sodium salt
Nalidixic acid sodium salt is an inhibitor of bacterial DNA polymerase (DNA gyrase) and avian myeloblastoma virus reverse transcriptase. It inhibits nucleic acid and protein synthesis in Saccharomyces cerevisiae. It is a naphthyridone antibiotic similar in structure and mechanism to quinolones.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3374-05-8 |
| Pricing | Inquire |
| Cas | 3374-05-8 |
| Molecular Weight | 254.22 |
| Molecular Formula | C12H11N2NaO3 |
| Canonical SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)[O-].[Na+] |