2-Chloro-9-(beta-D-ribofuranosyl)purine
2-Chloro-9-(beta-D-ribofuranosyl)purine, an extensive nucleoside analog, assumes a critical role in the realm of biomedicine, specifically in the management of viral infections. By selectively antagonizing viral enzymes or proteins essential for replication, this compound conspicuously hampers the pernicious growth of viruses, affirming its effectiveness across a spectrum of viral strains. Promisingly, its antiviral properties stimulate its integration into the intricate design of potent antiviral drugs, conferring an invaluable arsenal in combatting the relentless onslaught of infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5466-11-5 |
| Pricing | Inquire |
| Cas | 5466-11-5 |
| Molecular Weight | 286.67 |
| Molecular Formula | C10H11ClN4O4 |
| Canonical SMILES | C1=C2C(=NC(=N1)Cl)N(C=N2)C3C(C(C(O3)CO)O)O |