tert-butyl (2E)-3-phenylprop-2-enoate
tert-butyl (2E)-3-phenylprop-2-enoate is a remarkable and potent chemical compound that finds its utility in the realm of pharmaceuticals and biomedicine. Renowned for its multifaceted nature, this compound holds immense promise in combatting an array of afflictions, encompassing maladies like cancer, inflammation, and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7042-36-6 |
| Pricing | Inquire |
| Cas | 7042-36-6 |
| Molecular Weight | 204.2649 |
| Molecular Formula | C13H16O2 |
| Canonical SMILES | CC(C)(C)OC(=O)C=CC1=CC=CC=C1 |