L-Tyrosine,L-tyrosyl-L-tyrosyl-
Tyr-Tyr and Tyr-Tyr-Tyr efficiently inhibit angiotensin I-converting enzyme (ACE) from rabbit lung, their IC50 values were 34 μM and 51 μM, respectively. These two tyrosine peptides exhibited a mix of competitive and noncompetitive inhibitions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015634 |
| Pricing | Inquire |
| Cas | 7390-78-5 |
| Molecular Weight | 507.54 |
| Molecular Formula | C27H29N3O7 |
| Canonical SMILES | C1=CC(=CC=C1CC(C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)N)O |