Altromycin B
It is produced by the strain of Actinomycetes AB 1246E-26. It has anti-Gram-positive bacteria activity, and the MIC for Streptococcus and Staphylococcus is between 0.2-3.12ug/mL. It also has an inhibitory effect on a variety of tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00430 |
| Pricing | Inquire |
| Cas | 128461-00-7 |
| Molecular Weight | 925.96 |
| Molecular Formula | C47H59NO18 |
| Canonical SMILES | CC1C(C(CC(O1)OC2C(OC(CC2(C)N(C)C)C3=C(C4=C(C=C3)C(=O)C5=CC(=C6C(=O)C=C(OC6=C5C4=O)C7(C(O7)C)C)C(C8C(C(C(C(O8)C)O)OC)O)(C(=O)OC)O)O)C)OC)O |