6-Chloro-3-indoxyl-3-acetate
6-Chloro-3-indoxyl-3-acetate is an extraordinary biomedical compound, extensively employed in cutting-edge research and diagnostics. Flaunting its exquisite nature, this exceptional substrate exhilarates numerous enzymes, specifically β-galactosidase, effectively unraveling the enigmatic maze of lacZ gene expression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114305-99-6 |
| Pricing | Inquire |
| Cas | 114305-99-6 |
| Molecular Weight | 209.63 |
| Molecular Formula | C10H8ClNO2 |
| Canonical SMILES | CC(=O)OC1=CNC2=C1C=CC(=C2)Cl |