Tenuazonic acid
Tenuazonic acid is a nitrogen-containing heterocyclic antibiotic produced by Alternaria tenuis Auct 430 and Asp. sp. 1404. It has inhibitory effect on enterovirus, respiratory virus, vaccinia virus and herpes simplex virus. It can inhibit KB cells and amoeba in dysentery.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03498 |
| Pricing | Inquire |
| Cas | 610-88-8 |
| Molecular Weight | 197.23 |
| Molecular Formula | C10H15NO3 |
| Canonical SMILES | CCC(C)C1C(=C(C(=O)N1)C(=O)C)O |