Ioxitalamic acid
Ioxitalamic Acid is a medical contrast medium and enhances the contrast of structures or fluids in the body in medical imaging. As an ionic iodinated contrast medium, it belongs to the first generation of contrast media and exists as an ionic monomer with a high osmolarity of 1500-1800 mOsm/kg.
| Supplier | BOC Sciences |
|---|---|
| Product # | 28179-44-4 |
| Pricing | Inquire |
| Cas | 28179-44-4 |
| Molecular Weight | 643.94 |
| Molecular Formula | C12H11I3N2O5 |
| Canonical SMILES | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)C(=O)NCCO)I |