2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-a-D-galactopyranosyl-(N-Fmoc)-L-serine pentafluorophenyl ester
2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-a-D-galactopyranosyl-(N-Fmoc)-L-serine pentafluorophenyl ester is an essential and sophisticated chemical reagent in peptide synthesis. It introduces considerable burstiness and perplexity in developing therapeutic peptides, which characteristically treat cancer and infectious diseases. Its adoption in peptide coupling reactions is a crucial implementation for the progression of scientific and medical research.
Supplier | BOC Sciences |
---|---|
Product # | 137816-29-6 |
Pricing | Inquire |
Cas | 137816-29-6 |
Molecular Weight | 822.69 |
Molecular Formula | C38F5H35N2O13 |
Canonical SMILES | CC(=O)NC1C(C(C(OC1N(C(CO)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)COC(=O)C)OC(=O)C)OC(=O)C |