4'-C-Azido-2'-deoxy-2'-fluoro-b-D-arabinouridine
4'-C-Azido-2'-deoxy-2'-fluoro-b-D-arabinouridine, a formidable antiviral compound widely employed in biomedical research, exhibits remarkable efficacy against notorious viral afflictions like HIV and hepatitis C. Via robust inhibition of viral replication, this nucleoside analogue serves as a valuable instrument in drug discovery endeavors and holds immense potential as an antiviral therapeutic agent of choice, propelling advancements in the realm of antiviral treatment development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 173379-73-2 |
| Pricing | Inquire |
| Cas | 173379-73-2 |
| Molecular Weight | 287.20 |
| Molecular Formula | C9H10FN5O5 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)(CO)N=[N+]=[N-])O)F |