2'-Deoxy-6N-DMF-5'-O-DMT-adenosine
2'-Deoxy-6N-DMF-5'-O-DMT-adenosine, an essential biomolecular entity, emerges as a vital protagonist within the biomedical field. Acting as a pivotal constituent during the intricate synthesis of nucleic acids and DNA, this compound assumes a paramount role in the pursuit of therapeutic breakthroughs for an array of ailments such as cancer, viral infections, and genetic anomalies. With its unparalleled structural complexity and inherent characteristics, 2'-Deoxy-6N-DMF-5'-O-DMT-adenosine propels the frontier of biomedicine, fostering progressive inquiry and facilitating revolutionary treatment modalities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17331-20-3 |
| Pricing | Inquire |
| Cas | 17331-20-3 |
| Molecular Weight | 608.69 |
| Molecular Formula | C34H36N6O5 |
| Canonical SMILES | CN(C)C=NC1=C2C(=NC=N1)N(C=N2)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |