2,3,4-Tri-O-acetyl-b-D-arabinopyranosyl cyanide
2,3,4-Tri-O-acetyl-b-D-arabinopyranosyl cyanide, a powerful compound widely utilized in the biomedical sector, holds immense promise for combating specific ailments. Its significant anticancer attributes have exhibited considerable efficacy against diverse cancer cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89158-08-7 |
| Pricing | Inquire |
| Cas | 89158-08-7 |
| Molecular Weight | 285.25 |
| Molecular Formula | C12H15NO7 |
| Canonical SMILES | CC(=O)OC1COC(C(C1OC(=O)C)OC(=O)C)C#N |