Methyl 2,4-di-O-acetyl-b-D-xylopyranoside
Methyl 2,4-di-O-acetyl-b-D-xylopyranoside is a valuable compound used in the development of drugs for studying cancer. Additionally, this compound can be used as a modifying compound in the synthesis of various pharmaceuticals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74162-08-6 |
| Pricing | Inquire |
| Cas | 74162-08-6 |
| Molecular Weight | 248.2 |
| Molecular Formula | C10H16O7 |
| Canonical SMILES | CC(=O)OC1COC(C(C1O)OC(=O)C)OC |