Dynemicin A
It is produced by the strain of Micromonospora chersina sp. M 956-I and M. globosa. Dynemicin A has a strong killing effect on a variety of tumor cells at Pg/mL level. The cyclic enediyne part of enediyne antibiotics is cycled by Bergman to form aromatic diradicals, which quickly seize hydrogen atoms from the DNA skeleton and break the DNA strand, thus killing tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01775 |
| Pricing | Inquire |
| Cas | 124412-57-3 |
| Molecular Weight | 537.47 |
| Molecular Formula | C30H19NO9 |
| Canonical SMILES | CC1C(=C(C2C#CC=CC#CC3C14C2(O4)C5=CC(=C6C(=C5N3)C(=O)C7=C(C=CC(=C7C6=O)O)O)O)OC)C(=O)O |