β-Amanitin
β-Amanitin is a cyclic peptide toxin in the poisonous Amanita phalloides mushroom. β-Amanitin inhibits eukaryotic RNA polymerase II and III. β-Amanitin inhibits protein synthesis. β-Amanitin can be used as a cytotoxic component of antibody-drug conjugates (ADCs).
| Supplier | BOC Sciences |
|---|---|
| Product # | 21150-22-1 |
| Pricing | Inquire |
| Cas | 21150-22-1 |
| Molecular Weight | 919.95 |
| Molecular Formula | C39H53N9O15S |
| Canonical SMILES | CCC(C)C1C(=O)NCC(=O)NC2CS(=O)C3=C(CC(C(=O)NCC(=O)N1)NC(=O)C(NC(=O)C4CC(CN4C(=O)C(NC2=O)CC(=O)O)O)C(C)C(CO)O)C5=C(N3)C=C(C=C5)O |