1-Naphthyl b-D-glucuronide sodium salt
1-Naphthyl b-D-glucuronide sodium salt, an invaluable biomedicine, is employed extensively in scientific research to explore the intricate process of glucuronidation, which plays a vital role in the metabolism and elimination of a diverse array of pharmaceuticals and endogenous compounds. Acting as a versatile substrate, it facilitates the activities of glucuronosyltransferases, crucial enzymes that mediate glucuronidation reactions. Demonstrating immense utility in in vitro experiments, this product enables scientists to unravel the profound impact of glucuronidation on drug pharmacokinetics, while simultaneously facilitating the evaluation of potential drug-drug interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83833-12-9 |
| Pricing | Inquire |
| Cas | 83833-12-9 |
| Molecular Weight | 342.28 |
| Molecular Formula | C16H15NaO7 |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O.[Na+] |