5-(1-Piperidinylmethyl)thiophene-2-boronic acid pinacol ester
5-(1-Piperidinylmethyl)thiophene-2-boronic acid pinacol ester, with its exceptional structural attributes, assumes a pivotal part in the formulation of pharmaceuticals targeting diverse afflictions such as cancer, inflammation, and neurological disorders. The versatility of this compound renders it an indispensable asset, fostering the advancement of innovative therapeutic remedies by researchers and pharmaceutical enterprises.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1218790-44-3 |
| Pricing | Inquire |
| Cas | 1218790-44-3 |
| Molecular Weight | 307.3 |
| Molecular Formula | C16H26BNO2S |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CN3CCCCC3 |