3-[(4-(2-Methoxyethyl)phenoxy)methyl]phenylboronic acid
3-[(4-(2-Methoxyethyl)phenoxy)methyl]phenylboronic acid, a highly intricate biomedicine, exhibits remarkable potential in impeding the growth and metastasis of tumors by selectively inhibiting specified enzymes. By perturbing crucial pathways, this compound exerts a profound influence on restraining the advancement of malignancies, thereby augmenting patient prognoses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 871126-26-0 |
| Pricing | Inquire |
| Cas | 871126-26-0 |
| Molecular Weight | 286.13 |
| Molecular Formula | C16H19BO4 |
| Canonical SMILES | B(C1=CC(=CC=C1)COC2=CC=C(C=C2)CCOC)(O)O |