5'-O-dimethoxytrityl-N4-benzoyl-2'-deoxycytidine
5'-O-dimethoxytrityl-N4-benzoyl-2'-deoxycytidine is a modified nucleotide used in the synthesis of oligonucleotides for the treatment of cancer. It has been shown to be effective in increasing the stability and specificity of antisense oligonucleotides targeting certain oncogenes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105862-10-0 |
| Pricing | Inquire |
| Cas | 105862-10-0 |
| Molecular Weight | 573.64 |
| Molecular Formula | C35H31N3O5 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)O |