Diethylenetriaminepenta(methylenephosphonic) acid
DTPMPA can be used as scale and corrosion inhibitor in circulating cool water system and boiler water, especially in alkali circulating cool water without additional pH regulation. It can also be used in oilfield refill water, cool water and boiler water with high concentration of barium carbonate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15827-60-8 |
| Pricing | Inquire |
| Cas | 15827-60-8 |
| Molecular Weight | 573. 2 |
| Molecular Formula | C9H28O15N3P5 |
| Canonical SMILES | C(CN(CP(=O)(O)O)CP(=O)(O)O)N(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |