4-Methylumbelliferyl 2-acetamido-3-O-(b-D-galactopyranosyl)-a-D-galactopyranoside
4-Methylumbelliferyl 2-acetamido-3-O-(b-D-galactopyranosyl)-a-D-galactopyranoside is a biochemical compound used in the biomedical industry to study lysosomal storage diseases such as Fabry disease and Gaucher disease. It acts as a fluorogenic substrate for lysosomal enzymes, aiding in the detection and measurement of their activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 210357-36-1 |
| Pricing | Inquire |
| Cas | 210357-36-1 |
| Molecular Weight | 541.50 |
| Molecular Formula | C24H31NO13 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)O)O)NC(=O)C |