Clenbuterol Impurity A
4-Amino-3,5-dichlorobenzaldehyde is an impurity of Clenbuterol and is used as a reagent in the synthesis of pyrazolopyridine derivatives as inhibitors of phosphodiesterase-4 (PDE-IV) and production of tumor necrosis factor-α (TNF-α). 4-Amino-3,5-dichlorobenzaldehyde is also used as a reagent in the synthesis of amino acid derivatives as neuropeptide Y antagonists.
| Supplier | BOC Sciences |
|---|---|
| Product # | 62909-66-4 |
| Pricing | Inquire |
| Cas | 62909-66-4 |
| Molecular Weight | 190.03 |
| Molecular Formula | C7H5Cl2NO |
| Canonical SMILES | C1=C(C=C(C(=C1Cl)N)Cl)C=O |