4-Chloro-7-(2-deoxy-b-D-ribofuranosyl)-7H-pyrrolo[2,3-d]-pyrimidine
4-Chloro-7-(2-deoxy-b-D-ribofuranosyl)-7H-pyrrolo[2,3-d]-pyrimidine, a highly potent nucleoside analogue employed in the field of biomedicine, demonstrates efficacy against a wide range of viral infections encompassing herpes simplex virus, hepatitis B virus, and human immunodeficiency virus (HIV). Its mechanism of action involves impeding viral DNA synthesis, thereby curtailing viral replication and suppressing viral activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 97337-37-6 |
| Pricing | Inquire |
| Cas | 97337-37-6 |
| Molecular Weight | 269.68 |
| Molecular Formula | C11H12ClN3O3 |
| Canonical SMILES | C1C(C(OC1N2C=CC3=C2N=CN=C3Cl)CO)O |