S 12
S 12 is a survivin inhibitor that alters spindle formation, resulting in mitotic arrest (by disrupting metaphase at the G2/M stage) and apoptosis. It inhibits cell proliferation and tumor growth independently of p53 status.
| Supplier | BOC Sciences |
|---|---|
| Product # | 258264-62-9 |
| Pricing | Inquire |
| Cas | 258264-62-9 |
| Molecular Weight | 390.18 |
| Molecular Formula | C17H12BrNO5 |
| Canonical SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)CC3(C4=C(C=CC(=C4)Br)NC3=O)O |