7α,24(S)-dihydroxycholesterol
7α,24(S)-dihydroxycholesterol is a sterol found to be one of several, the most abundant cholesterol metabolites and an intermediate of bile acid biosynthetic pathways. 7α,24(S)-dihydroxycholesterol is a ligand for liver X receptor (LXR) and binds to the ligand binding domain of LXRα and LXRβ.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-3311 |
| Pricing | Inquire |
| Cas | 245523-67-5 |
| Molecular Weight | 418.65 |
| Molecular Formula | C27H46O3 |
| Canonical SMILES | CC(C)C(CCC(C)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C)O |