6-O-butyl castanospermine
Celgosivir, an effective α-glucosidase I inhibitor, has been found to be related to viral maturation and is still under Phase I/II trial against Dengue. IC50: 16 and 47 umol/L (through plaque assay and a cytopathic assay).
| Supplier | BOC Sciences |
|---|---|
| Product # | 121104-96-9 |
| Pricing | Inquire |
| Cas | 121104-96-9 |
| Molecular Weight | 259.30 |
| Molecular Formula | C12H21NO5 |
| Canonical SMILES | CCCC(=O)OC1CN2CCC(C2C(C1O)O)O |