Fostamatinib sodium
R788 (Fostamatinib) disodium, a prodrug of the active metabolite R406, is a Syk inhibitor with IC50 of 41 nM, strongly inhibits Syk but not Lyn, 5-fold less potent to Flt3. Phase 3.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1025687-58-4 |
| Pricing | Inquire |
| Cas | 1025687-58-4 |
| Molecular Weight | 624.42 |
| Molecular Formula | C23H24FN6O9P.2Na |
| Canonical SMILES | CC1(C(=O)N(C2=C(O1)C=CC(=N2)NC3=NC(=NC=C3F)NC4=CC(=C(C(=C4)OC)OC)OC)COP(=O)([O-])[O-])C.[Na+].[Na+] |