Heptyl b-D-glucopyranoside
Heptyl b-D-glucopyranoside, a frequently utilized compound in the biomedical sector, presents substantial promise as a drug carrier, particularly for the treatment of ailments such as cancer. Its capacity to augment drug effectiveness and diminish toxicity renders it a highly favorable prospect for targeted drug delivery systems. Given its manifold properties and advantages, it assumes a paramount role in diverse biomedical applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 78617-12-6 |
| Pricing | Inquire |
| Cas | 78617-12-6 |
| Molecular Weight | 278.34 |
| Molecular Formula | C13H26O6 |
| Canonical SMILES | CCCCCCCOC1C(C(C(C(O1)CO)O)O)O |