PDK4-IN-1
PDK4-IN-1 is a potent and orally active pyruvate dehydrogenase kinase 4 (PDK4) inhibitor with an IC50 value of 84 nM. PDK4-IN-1 potently represses cellular transformation and cellular proliferation and induces apoptosis. It also has antidiabetic, anticancer and anti-allergic activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2310262-10-1 |
| Pricing | Inquire |
| Cas | 2310262-10-1 |
| Molecular Weight | 357.41 |
| Molecular Formula | C22H19N3O2 |
| Canonical SMILES | C1CNCCC1N2C=C(C=N2)C3=C4C(=CC=C3)C(=O)C5=CC=CC=C5C4=O |