4-(N-Phenylamino)-4-carboxypiperidine
4-(N-Phenylamino)-4-carboxypiperidine is an intermediate in the synthesis of Remifentanil Ester Hydrochloride (R143515), a controlled substance, an Opioid. Remifentanil Esters are used as intermediates in the synthesis of isothiocyanate derivatives of carfentanils and (methoxymethyl)fentanyls which are opioid δ receptor irreversible inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058234 |
| Pricing | Inquire |
| Cas | 772283-93-9 |
| Molecular Weight | 220.27 |
| Molecular Formula | C12H16N2O2 |
| Canonical SMILES | C1CNCCC1(C(=O)O)NC2=CC=CC=C2 |