6,4'-Dihydroxy-7-methoxyflavanone
6,4'-Dihydroxy-7-methoxyflavanone is a natural compound isolated from the heartwood of Dalbergia odorifera. 6,4'-Dihydroxy-7-methoxyflavanone shows inhibition of osteoclasts differentiation and function, thus it can be a potential therapeutic molecule for osteoclastogenic bone diseases such as osteoporosis, rheumatoid arthritis and periodontal diseases. 6,4'-Dihydroxy-7-methoxyflavanone has antioxidant, anti-inflammatory and neuroprotective effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2425 |
| Pricing | Inquire |
| Cas | 189689-32-5 |
| Molecular Weight | 286.27 |
| Molecular Formula | C16H14O5 |
| Canonical SMILES | COC1=C(C=C2C(=O)CC(OC2=C1)C3=CC=C(C=C3)O)O |