2,3-O-Isopropylidene-1,6-di-O-p-toluenesulfonyl-a-L-sorbofuranose
2,3-O-Isopropylidene-1,6-di-O-p-toluenesulfonyl-α-L-sorbofuranose, an essential component in the biomedical field, showcases immense possibilities in carbohydrate derivative synthesis and glycosylation reactions. As a result of its distinctive configuration, this compound illustrates immense promise in combating a wide range of ailments such as cancer, cardiovascular disorders, and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2484-55-1 |
| Pricing | Inquire |
| Cas | 2484-55-1 |
| Molecular Weight | 528.59 |
| Molecular Formula | C23H28O10S2 |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2C(C3C(O2)(OC(O3)(C)C)COS(=O)(=O)C4=CC=C(C=C4)C)O |