Prostaglandin A2-[d4]
Prostaglandin A2-[d4] is the isotope labelled analog of Prostaglandin A2. Prostaglandin A2 is a naturally occurring prostaglandin in gorgonian corals where it may function in self defense. Prostaglandin A2 is generally not present in mammals. Prostaglandin A2 has also been shown to act as a vasodilator with natriuretic properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-008626 |
| Pricing | Inquire |
| Cas | 201608-18-6 |
| Molecular Weight | 338.45 |
| Molecular Formula | C20H26D4O4 |
| Canonical SMILES | CCCCCC(C=CC1C=CC(=O)C1CC=CCCCC(=O)O)O |