2',3'-O-Isopropylidene-5'-oxo-8,5'-cycloadenosine
2',3'-O-Isopropylidene-5'-oxo-8,5'-cycloadenosine is a compound with fectively suppresses the intricate process of DNA and RNA amalgamation. Notably, this remarkable substance finds extensive application in the research on combating various forms of malignant neoplasms like leukemia and solid tumors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 33066-26-1 |
| Pricing | Inquire |
| Cas | 33066-26-1 |
| Molecular Weight | 303.27 |
| Molecular Formula | C13H13N5O4 |
| Canonical SMILES | CC1(OC2C(O1)C3N4C(=NC5=C(N=CN=C54)N)C(=O)C2O3)C |