2',3'-Di-O-methyladenosine
2',3'-Di-O-methyladenosine, a compound of utmost importance, finds extensive utility in the biomedical field owing to its immense potential for therapeutic purposes. In the realm of disease management, particularly in cancer, neurodegenerative disorders, and viral infections, this product assumes a pivotal role. Its remarkable chemical composition and distinct pharmacological characteristics render it an exceedingly propitious contender for targeted pharmaceutical administration and individualized medical interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20649-46-1 |
| Pricing | Inquire |
| Cas | 20649-46-1 |
| Molecular Weight | 295.29 |
| Molecular Formula | C12H17N5O4 |
| Canonical SMILES | COC1C(OC(C1OC)N2C=NC3=C(N=CN=C32)N)CO |