4-Bromo-2-fluorophenylzinc iodide solution
4-Bromo-2-fluorophenylzinc iodide solution is a versatile compound in the realm of biomedicine and showcases its wide-ranging potential as a multifaceted precursor in the synthesis of pharmaceutical agents, meticulously devised to confront a plethora of afflictions encompassing cancer, viral infections, and neuronal decay.
| Supplier | BOC Sciences |
|---|---|
| Product # | 352530-44-0 |
| Pricing | Inquire |
| Cas | 352530-44-0 |
| Molecular Weight | 366.28 |
| Molecular Formula | BrC6H3(F)ZnI |
| Canonical SMILES | C1=CC(=CC(=[C-]1)F)Br.[Zn+]I |