Rebaudioside G
Rebaudioside G is also known as Reb G, a captivating natural sweetener extracted from the stevia plant. As an exceptional sugar substitute, it diligently used for studying ramifications associated with obesity and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 127345-21-5 |
| Pricing | Inquire |
| Cas | 127345-21-5 |
| Molecular Weight | 804.87 |
| Molecular Formula | C38H60O18 |
| Canonical SMILES | CC12CCCC(C1CCC34C2CCC(C3)(C(=C)C4)OC5C(C(C(C(O5)CO)O)OC6C(C(C(C(O6)CO)O)O)O)O)(C)C(=O)OC7C(C(C(C(O7)CO)O)O)O |