Curromycin B
It is produced by the strain of Streptomyces hygroscipicus 358AV2. It has antibacterial activity against gram-positive bacteria such as Bacillus subtilis. It can inhibit the replication of human immunodeficiency virus (HIV), inhibit mouse melanoma B16 and leukemia P388 cells.
Supplier | BOC Sciences |
---|---|
Product # | BBF-01093 |
Pricing | Inquire |
Cas | 97412-77-6 |
Molecular Weight | 683.84 |
Molecular Formula | C37H53N3O9 |
Canonical SMILES | CC1C(=O)N(C2(C1(C(CC(C)C(C=CC=CCNC(=O)C(C)(C)C(C(=CC=CC=CCC3=CN=C(O3)C)C)O)O)OC)O)C(OC2=O)C)C |