Bz-G-(S)-GNA phosphoramidite
Bz-G-(S)-GNA phosphoramidite: A Potent Anticancer and Antiviral Reagent for DNA Synthesis and Modification. This widely employed derivative is recognized for its high-purity and stability, enabling the synthesis of oligonucleotides with amplified efficacy and selectivity. Renowned for its use in drug discovery and development, the Bz-G-(S)-GNA nucleoside intermediate supports treatment of devastating conditions like HIV and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 182625-68-9 |
| Pricing | Inquire |
| Cas | 182625-68-9 |
| Molecular Weight | 797.88 |
| Molecular Formula | C44H52N7O7P |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2CC(COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N |