{3-[(3,5-dimethoxyphenyl)methoxy]-2,6-difluorophenyl}boronic acid
{3-[(3,5-dimethoxyphenyl)methoxy]-2,6-difluorophenyl}boronic acid is a boronic acid derivative commonly used in biomedical research. Notably, it plays a crucial role in the discovery and development of novel anticancer drugs due to its ability to react with organic compounds in Suzuki coupling reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 849062-01-7 |
| Pricing | Inquire |
| Cas | 849062-01-7 |
| Molecular Weight | 324.084 |
| Molecular Formula | C15H15BF2O5 |
| Canonical SMILES | B(C1=C(C=CC(=C1F)OCC2=CC(=CC(=C2)OC)OC)F)(O)O |