Salcaprozate sodium
Salcaprozate sodium (SNAC) is used as an excipient in drug formulation as a chemical permeation enhancer (PE) to aid the oral absorption of macromolecules, peptides and proteins such as insulin (diabetes), heparin (heart attacks and angina) and cyanocobalamin (vitamin B12 deficiency and anaemia) which would otherwise have poor bioavailability. SNAC is considered to be safe for human consumption (GRAS) by the FDA.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010174 |
| Pricing | Inquire |
| Cas | 203787-91-1 |
| Molecular Weight | 301.31 |
| Molecular Formula | C15H20NNaO4 |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)[O-])O.[Na+] |