Octyl a-D-galactopyranoside
Octyl a-D-galactopyranoside is a bioactive compound widely used in the biomedical industry with excellent surfactant properties, playing a crucial role in cellular research and drug delivery systems. This versatile product is particularly valuable in biochemical studies involving the purification and solubilization of membrane proteins aiding in studying various diseases such as cancer and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149342-80-3 |
| Pricing | Inquire |
| Cas | 149342-80-3 |
| Molecular Weight | 292.37 |
| Molecular Formula | C14H28O6 |
| Canonical SMILES | CCCCCCCCOC1C(C(C(C(O1)CO)O)O)O |