2,5-Dibromobenzoic acid
2,5-Dibromobenzoic acid (CAS# 610-71-9) is an intermediate used to prepare benzo[c]chromenone and benzo[c]chromene derivatives as estrogen β-receptor-selective agonists in comparison with effusol and estradiol. It is also used in the synthesis of aminopyridine-based c-Jun N-terminal kinase inhibitors with cellular activity and minimal cross-kinase activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 610-71-9 |
| Pricing | Inquire |
| Cas | 610-71-9 |
| Molecular Weight | 279.91 |
| Molecular Formula | C7H4Br2O2 |
| Canonical SMILES | C1=CC(=C(C=C1Br)C(=O)O)Br |