AP-1/NF-κB activation inhibitor 1
AP-1/NF-κB activation inhibitor 1 is a potent AP-1 and NF-κB mediated transcriptional activation inhibitor with an IC50 of 1 μM. AP-1/NF-κB activation inhibitor 1 has a similar inhibitory effect on the production of IL-2 and IL-8 levels in stimulated cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 188936-12-1 |
| Pricing | Inquire |
| Cas | 188936-12-1 |
| Molecular Weight | 344.25 |
| Molecular Formula | C13H11F3N4O4 |
| Canonical SMILES | CCOC(=O)C1=CN=C(N=C1NN2C(=O)C=C(C2=O)C)C(F)(F)F |