Epiandrosterone b-D-glucuronide
Epiandrosterone is an innate steroid hormone, and Epiandrosterone b-D-glucuronide manifests as a glucuronide conjugate. Predominantly employed in the realm of biomedical inquiry, it is used to unravel the intricate web of Epiandrosterone's metabolism and excretion within the corporeal domain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4271-00-5 |
| Pricing | Inquire |
| Cas | 4271-00-5 |
| Molecular Weight | 466.56 |
| Molecular Formula | C25H38O8 |
| Canonical SMILES | CC12CCC(CC1CCC3C2CCC4(C3CCC4=O)C)OC5C(C(C(C(O5)C(=O)O)O)O)O |