Simvastatin EP Impurity M
An impurity of Simvastatin. Simvastatin is a lipid-lowering drug that inhibits HMG-CoA reductase. It is in the statin class of medications and works by decreasing the manufacture of cholesterol by the liver.
| Supplier | BOC Sciences |
|---|---|
| Product # | 864357-87-9 |
| Pricing | Inquire |
| Cas | 864357-87-9 |
| Molecular Weight | 464.63 |
| Molecular Formula | C27H44O6 |
| Canonical SMILES | CCC(C)(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC(CC(CC(=O)OCC)O)O)C |