Methyl 4-O-(a-D-galactopyranosyl)-a-D-galactopyranoside
Methyl 4-O-(α-D-galactopyranosyl)-α-D-galactopyranoside is a bioactive compound, widely utilized in studying a diverse range of ailments including diabetes, cancer and inflammation. Notably, this compound serves as a facilitator of glycosylation, thereby augmenting the efficacy of drug delivery and bioavailability.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67145-39-5 |
| Pricing | Inquire |
| Cas | 67145-39-5 |
| Molecular Weight | 356.32 |
| Molecular Formula | C13H24O11 |
| Canonical SMILES | COC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |